Dinuclear and layered copper 2-pyridylphosphonates with weak ferromagnetism observed in layer compound Cu(C5H4NPO3).
نویسندگان
چکیده
This paper reports the syntheses and structures of three new copper phosphonates based on 2-pyridylphosphonate, namely, Cu(C(5)H(4)NPO(3)H)2 (1), Cu3(OH)2(C(5)H(4)NPO(3))2.2H2O (2) and Cu(C(5)H(4)NPO(3)) (3). Compound 1 has a discrete dimeric structure in which the {CuO(4)N} square pyramids are linked by the {CPO(3)} tetrahedra through corner-sharing. The dimers are further connected into a chain through hydrogen bonds. In compound 2, edge-sharing {Cu(1)O(4)N} square pyramids and {Cu(2)O(4)} planes are found to form an infinite chain with composition {Cu(3)(mu-OH)(2)(mu-O)(4)}. Neighboring chains are linked by the phosphonate groups of the 2-pyridylphosphonate ligands, resulting in inorganic layers containing 4-, 8- and 12-membered rings. The pyridyl groups and the lattice water molecules occupy the inter-layer space. In compound 3, the {Cu(1)O(4)} and {Cu(2)O(2)N(2)} planes are each corner-shared with the {CPO(3)} tetrahedra, forming an inorganic layer containing 8- and 16-membered rings. The pyridyl groups reside between the layers. Crystal data for 1: space group P(-)1, a = 8.4045(19), b = 8.751(2), c = 10.632(2) A, alpha = 66.673(4), beta = 72.566(4), gamma = 70.690(4) degrees , V = 664.7(2) A(3), Z = 2. Crystal data for 2: space group P2(1)/c, a = 7.9544(17), b = 21.579(4), c = 5.0243(10) A, beta = 105.332(3) degrees , V = 831.7(3) A(3), Z = 2. Crystal data for 3: space group P2(1)/c, a = 4.7793(11), b = 15.319(3), c = 8.6022(19) A, beta = 97.156(4) degrees , V = 624.9(2) A(3), Z = 4. Magnetic measurements reveal that dominant antiferromagnetic interactions are propagated between the copper centers in compounds 1-3. For 3, spin canting is observed with a ferromagnetic transition occurring at 9 K.
منابع مشابه
A novel discrete dinuclear copper(II)–gadolinium(III) complex derived from a Schiff
The synthesis, X-ray and e.p.r. spectral studies of a 3d–4f couple are described here. The crystal structure of [Cu(salbn)Gd(NO3)3 ÆH2O], (2), salbn 1⁄4 N,N¢-butylenebis(salicylideaminato), has been determined by X-ray crystallography. Compound (2) crystallizes in the monoclinic system, space group p21/n, with a 1⁄4 9.025(1), b 1⁄4 22.912(1), c 1⁄4 12.790(1) Å, b 1⁄4 99:36(1), Z 1⁄4 4. The devi...
متن کاملStructural, MALDI-TOF-MS, magnetic and spectroscopic studies of new dinuclear copper(II), cobalt(II) and zinc(II) complexes containing a biomimicking μ-OH bridge.
The Py(2)N(4)S(2) octadentate coordinating ligand afforded dinuclear cobalt, copper and zinc complexes and the corresponding mixed metal compounds. The overall geometry and bonding modes have been deduced on the basis of elemental analysis data, MALDI-TOF-MS, IR, UV-vis and EPR spectroscopies, single-crystal X-Ray diffraction, conductivity and magnetic susceptibility measurements. In the copper...
متن کاملTetra-μ-acetato-κ8 O:O′-bis{[2,2-dimethyl-N-(pyridin-2-yl)propanamide-κN 1]copper(II)}(Cu—Cu)
The crystal structure of the title compound, [Cu(2)(C(2)H(3)O(2))(4)(C(10)H(14)N(2)O)(2)], reveals a dinuclear Cu(II) complex located about a center of inversion. The coordination environment of each Cu(II) cation is distorted octa-hedral, composed of four bridging acetate ligands, an apical pyridine donor and is completed by a Cu-Cu bond. The amide H atom forms intra-molecular hydrogen bonds t...
متن کاملCrystal structure of bis{μ-1-[(E)-(3-methoxyphenyl)diazenyl]naphthalen-2-olato-κ3 N 2,O:O}bis({1-[(E)-(3-methoxyphenyl)diazenyl]naphthalen-2-olato-κ2 N 2,O}copper(II))
The title dinuclear Cu(II) complex, [Cu2(C17H13N2O2)4], is located on an inversion centre. The Cu(II) atoms are each five-coordinated in a distorted square-pyramidal geometry by two N atoms and two O atoms from two bidentate ligands and one bridging O atom from another ligand. In the dinuclear complex, the Cu⋯Cu separation is 3.366 (3) Å. In the crystal, complex mol-ecules are linked via weak C...
متن کاملTetrakis(μ-2-methylbenzoato)bis[(2-methylbenzoic acid)copper(II)]
In the title centrosymmetric dinuclear compound, [Cu(2)(C(8)H(7)O(2))(4)(C(8)H(8)O(2))(2)], four o-toluate anions form a cage around two Cu atoms in a syn-syn configuration. Two more o-toluic acid mol-ecules are apically bonded to the Cu atoms, which show a square-pyramidal coordination geometry. The acid H atoms are hydrogen bonded to the cage carboxyl O atoms [O⋯O = 2.660 (2) Å]. The mol-ecul...
متن کاملذخیره در منابع من
با ذخیره ی این منبع در منابع من، دسترسی به آن را برای استفاده های بعدی آسان تر کنید
عنوان ژورنال:
- Dalton transactions
دوره 26 شماره
صفحات -
تاریخ انتشار 2006